![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Block making in site/ | 2012-05-23 08:42 | - | |
| Building-the-caretakers-house-in-64-hours/ | 2012-05-23 08:42 | - | |
| Earth Tunnel - Rain water/ | 2012-05-23 08:42 | - | |
| Finishes/ | 2012-05-23 08:42 | - | |
| Flooring Structure/ | 2012-05-23 08:42 | - | |
| Ground Floor/ | 2012-05-23 08:42 | - | |
| Inaguration/ | 2012-05-23 08:42 | - | |
| Laying the Foundation stone/ | 2012-05-23 08:42 | - | |
| Making blocks in the Auroville Earth Institute premises/ | 2012-05-23 08:42 | - | |
| Plinth/ | 2012-05-23 08:42 | - | |
| Preacasting in earth institute/ | 2012-05-23 08:42 | - | |
| Rammed earth foundation/ | 2012-05-23 08:42 | - | |
| Ring + spring beam/ | 2012-05-23 08:42 | - | |
| Site Precasting/ | 2012-05-23 08:42 | - | |
| Site Preparation/ | 2012-05-23 08:42 | - | |
| Tree Planting/ | 2012-05-23 08:42 | - | |
| Vaulted structure 1st floor/ | 2012-05-23 08:42 | - | |
| Vaults and Domes/ | 2012-05-23 08:42 | - | |